C26H25N3O3 — CID 3800061
2-oxo-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)chromene-3-carboxamide (PubChem CID 3800061) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-oxo-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)chromene-3-carboxamide.
| Compound Name | 2-oxo-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 3800061 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-oxo-N-(3,6,6-trimethyl-1-phenyl-5,7-dihydro-4H-indazol-4-yl)chromene-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(NC(=O)c1cc3ccccc3oc1=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H25N3O3/c1-16-23-20(27-24(30)19-13-17-9-7-8-12-22(17)32-25(19)31)14-26(2,3)15-21(23)29(28-16)18-10-5-4-6-11-18/h4-13,20H,14-15H2,1-3H3,(H,27,30) |
| InChIKey | NGINISUUMKQLGA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|