C28H25N5O6 — CID 177381603
2-(diethylamino)-6-methyl-4-oxo-N'-(2-oxochromene-3-carbonyl)-3-phenylfuro[2,3-d]pyrimidine-5-carbohydrazide (PubChem CID 177381603) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is 2-(diethylamino)-6-methyl-4-oxo-N'-(2-oxochromene-3-carbonyl)-3-phenylfuro[2,3-d]pyrimidine-5-carbohydrazide.
| Compound Name | 2-(diethylamino)-6-methyl-4-oxo-N'-(2-oxochromene-3-carbonyl)-3-phenylfuro[2,3-d]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 177381603 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 2-(diethylamino)-6-methyl-4-oxo-N'-(2-oxochromene-3-carbonyl)-3-phenylfuro[2,3-d]pyrimidine-5-carbohydrazide |
| SMILES | CCN(CC)c1nc2oc(C)c(C(=O)NNC(=O)c3cc4ccccc4oc3=O)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H25N5O6/c1-4-32(5-2)28-29-25-22(26(36)33(28)18-12-7-6-8-13-18)21(16(3)38-25)24(35)31-30-23(34)19-15-17-11-9-10-14-20(17)39-27(19)37/h6-15H,4-5H2,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | KQFDKOGASODFTE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 139.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|