C13H23ClN2O5 — CID 10245600
ethyl 2-[(2-chloroacetyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetate (PubChem CID 10245600) has the molecular formula C13H23ClN2O5 and a molecular weight of 322.79 g/mol. Its IUPAC name is ethyl 2-[(2-chloroacetyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetate.
| Compound Name | ethyl 2-[(2-chloroacetyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 10245600 |
| Molecular Formula | C13H23ClN2O5 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | ethyl 2-[(2-chloroacetyl)-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCNC(=O)OC(C)(C)C)C(=O)CCl |
| InChI | InChI=1S/C13H23ClN2O5/c1-5-20-11(18)9-16(10(17)8-14)7-6-15-12(19)21-13(2,3)4/h5-9H2,1-4H3,(H,15,19) |
| InChIKey | UDKLVGXGBJYHNS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|