C13H25ClN2O3 — CID 135138778
tert-butyl N-[3-[(2-chloroacetyl)-methylamino]-2,2-dimethylpropyl]carbamate (PubChem CID 135138778) has the molecular formula C13H25ClN2O3 and a molecular weight of 292.81 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-chloroacetyl)-methylamino]-2,2-dimethylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-chloroacetyl)-methylamino]-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 135138778 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | tert-butyl N-[3-[(2-chloroacetyl)-methylamino]-2,2-dimethylpropyl]carbamate |
| SMILES | CN(CC(C)(C)CNC(=O)OC(C)(C)C)C(=O)CCl |
| InChI | InChI=1S/C13H25ClN2O3/c1-12(2,3)19-11(18)15-8-13(4,5)9-16(6)10(17)7-14/h7-9H2,1-6H3,(H,15,18) |
| InChIKey | FXWPGCGIWVKMHW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|