C15H29N3O4S — CID 84557596
ethyl 3-[ethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioyl]amino]propanoate (PubChem CID 84557596) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is ethyl 3-[ethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioyl]amino]propanoate.
| Compound Name | ethyl 3-[ethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioyl]amino]propanoate |
|---|---|
| PubChem CID | 84557596 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | ethyl 3-[ethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamothioyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(CC)C(=S)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O4S/c1-6-18(11-8-12(19)21-7-2)13(23)16-9-10-17-14(20)22-15(3,4)5/h6-11H2,1-5H3,(H,16,23)(H,17,20) |
| InChIKey | FLPSBXPBBXMKEI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|