C22H23Cl2NO4 — CID 102456658
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-2-oxopiperidine-3-carboxylic acid (PubChem CID 102456658) has the molecular formula C22H23Cl2NO4 and a molecular weight of 436.34 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-2-oxopiperidine-3-carboxylic acid.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-2-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 102456658 |
| Molecular Formula | C22H23Cl2NO4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(2S)-1-hydroxybutan-2-yl]-2-oxopiperidine-3-carboxylic acid |
| SMILES | CC[C@@H](CO)N1C(=O)[C@@H](C(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23Cl2NO4/c1-2-17(12-26)25-20(13-6-8-15(23)9-7-13)18(11-19(21(25)27)22(28)29)14-4-3-5-16(24)10-14/h3-10,17-20,26H,2,11-12H2,1H3,(H,28,29)/t17-,18+,19-,20+/m0/s1 |
| InChIKey | QFBWJARGZRBJBR-ZGXWSNOMSA-N |
| XLogP | 4.52 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|