C28H33Cl2NO4 — CID 67999694
ethyl 2-[2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butoxy]acetate (PubChem CID 67999694) has the molecular formula C28H33Cl2NO4 and a molecular weight of 518.48 g/mol. Its IUPAC name is ethyl 2-[2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butoxy]acetate.
| Compound Name | ethyl 2-[2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butoxy]acetate |
|---|---|
| PubChem CID | 67999694 |
| Molecular Formula | C28H33Cl2NO4 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | ethyl 2-[2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butoxy]acetate |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)COCC(=O)OCC)C1=O |
| InChI | InChI=1S/C28H33Cl2NO4/c1-4-8-21-16-25(20-9-7-10-23(30)15-20)27(19-11-13-22(29)14-12-19)31(28(21)33)24(5-2)17-34-18-26(32)35-6-3/h4,7,9-15,21,24-25,27H,1,5-6,8,16-18H2,2-3H3/t21-,24?,25+,27+/m0/s1 |
| InChIKey | RZMJMSHZDKMURS-WUBDNDQTSA-N |
| XLogP | 6.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|