C25H27Cl2NO3 — CID 76834658
methyl 2-[3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanoate (PubChem CID 76834658) has the molecular formula C25H27Cl2NO3 and a molecular weight of 460.40 g/mol. Its IUPAC name is methyl 2-[3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanoate.
| Compound Name | methyl 2-[3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanoate |
|---|---|
| PubChem CID | 76834658 |
| Molecular Formula | C25H27Cl2NO3 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | methyl 2-[3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanoate |
| SMILES | C=CCC1CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(C(CC)C(=O)OC)C1=O |
| InChI | InChI=1S/C25H27Cl2NO3/c1-4-7-18-15-21(17-8-6-9-20(27)14-17)23(16-10-12-19(26)13-11-16)28(24(18)29)22(5-2)25(30)31-3/h4,6,8-14,18,21-23H,1,5,7,15H2,2-3H3 |
| InChIKey | RVQRZDKEOMKKSY-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|