C24H27Cl2NO2 — CID 67998288
(3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-hydroxybutan-2-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 67998288) has the molecular formula C24H27Cl2NO2 and a molecular weight of 432.39 g/mol. Its IUPAC name is (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-hydroxybutan-2-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-hydroxybutan-2-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 67998288 |
| Molecular Formula | C24H27Cl2NO2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (3S,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(1-hydroxybutan-2-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CC)CO)C1=O |
| InChI | InChI=1S/C24H27Cl2NO2/c1-3-6-18-14-22(17-7-5-8-20(26)13-17)23(16-9-11-19(25)12-10-16)27(24(18)29)21(4-2)15-28/h3,5,7-13,18,21-23,28H,1,4,6,14-15H2,2H3/t18-,21?,22+,23+/m0/s1 |
| InChIKey | QPIFPUHUNWWKLF-AFINUERQSA-N |
| XLogP | 6.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|