C26H29Cl2N3O3 — CID 123189001
(2S)-N-acetyl-2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanehydrazide (PubChem CID 123189001) has the molecular formula C26H29Cl2N3O3 and a molecular weight of 502.44 g/mol. Its IUPAC name is (2S)-N-acetyl-2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanehydrazide.
| Compound Name | (2S)-N-acetyl-2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanehydrazide |
|---|---|
| PubChem CID | 123189001 |
| Molecular Formula | C26H29Cl2N3O3 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (2S)-N-acetyl-2-[(2S,3R,5S)-3-(3-chlorophenyl)-2-(4-chlorophenyl)-6-oxo-5-prop-2-enylpiperidin-1-yl]butanehydrazide |
| SMILES | C=CC[C@H]1C[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@@H](CC)C(=O)N(N)C(C)=O)C1=O |
| InChI | InChI=1S/C26H29Cl2N3O3/c1-4-7-19-15-22(18-8-6-9-21(28)14-18)24(17-10-12-20(27)13-11-17)30(25(19)33)23(5-2)26(34)31(29)16(3)32/h4,6,8-14,19,22-24H,1,5,7,15,29H2,2-3H3/t19-,22+,23-,24+/m0/s1 |
| InChIKey | ASELQKKVTJCRKE-GMHONNGPSA-N |
| XLogP | 5.27 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|