C19H16N2O2 — CID 102457122
(1R,12R,16S)-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one (PubChem CID 102457122) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is (1R,12R,16S)-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one.
| Compound Name | (1R,12R,16S)-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one |
|---|---|
| PubChem CID | 102457122 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (1R,12R,16S)-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one |
| SMILES | O=C1[C@@H]2C(c3ccccc3)=NO[C@@H]2[C@H]2c3ccccc3CCN12 |
| InChI | InChI=1S/C19H16N2O2/c22-19-15-16(13-7-2-1-3-8-13)20-23-18(15)17-14-9-5-4-6-12(14)10-11-21(17)19/h1-9,15,17-18H,10-11H2/t15-,17-,18+/m1/s1 |
| InChIKey | YAGQRHOLCLTTAV-NXHRZFHOSA-N |
| XLogP | 2.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |