C20H18N2O2 — CID 122401448
(1S,9R,12R,16S)-9-methyl-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one (PubChem CID 122401448) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (1S,9R,12R,16S)-9-methyl-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one.
| Compound Name | (1S,9R,12R,16S)-9-methyl-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one |
|---|---|
| PubChem CID | 122401448 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (1S,9R,12R,16S)-9-methyl-13-phenyl-15-oxa-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,13-tetraen-11-one |
| SMILES | C[C@@H]1Cc2ccccc2[C@H]2[C@H]3ON=C(c4ccccc4)[C@H]3C(=O)N12 |
| InChI | InChI=1S/C20H18N2O2/c1-12-11-14-9-5-6-10-15(14)18-19-16(20(23)22(12)18)17(21-24-19)13-7-3-2-4-8-13/h2-10,12,16,18-19H,11H2,1H3/t12-,16-,18+,19+/m1/s1 |
| InChIKey | IYXOENKYNSUMAA-YXUXOOTASA-N |
| XLogP | 2.93 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |