C38H20Br4N2 — CID 102457644
6,7,12,13-tetrakis(4-bromophenyl)-5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene (PubChem CID 102457644) has the molecular formula C38H20Br4N2 and a molecular weight of 824.21 g/mol. Its IUPAC name is 6,7,12,13-tetrakis(4-bromophenyl)-5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene.
| Compound Name | 6,7,12,13-tetrakis(4-bromophenyl)-5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
|---|---|
| PubChem CID | 102457644 |
| Molecular Formula | C38H20Br4N2 |
| Molecular Weight | 824.21 g/mol |
| Exact Mass | 819.84 |
| IUPAC Name | 6,7,12,13-tetrakis(4-bromophenyl)-5,14-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaene |
| SMILES | Brc1ccc(-c2nc3ccc4nc(-c5ccc(Br)cc5)c(-c5ccc(Br)cc5)c5ccc(c2-c2ccc(Br)cc2)c3c45)cc1 |
| InChI | InChI=1S/C38H20Br4N2/c39-25-9-1-21(2-10-25)33-29-17-18-30-34(22-3-11-26(40)12-4-22)38(24-7-15-28(42)16-8-24)44-32-20-19-31(35(29)36(30)32)43-37(33)23-5-13-27(41)14-6-23/h1-20H |
| InChIKey | OSPZJQXVFPKGQF-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.21 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|