C34H36N2O3S — CID 102458993
2-[(2S,3S)-3-(dibenzylamino)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1-phenylethanone (PubChem CID 102458993) has the molecular formula C34H36N2O3S and a molecular weight of 552.74 g/mol. Its IUPAC name is 2-[(2S,3S)-3-(dibenzylamino)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(2S,3S)-3-(dibenzylamino)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 102458993 |
| Molecular Formula | C34H36N2O3S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 2-[(2S,3S)-3-(dibenzylamino)-1-(4-methylphenyl)sulfonylpiperidin-2-yl]-1-phenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](N(Cc3ccccc3)Cc3ccccc3)[C@@H]2CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N2O3S/c1-27-19-21-31(22-20-27)40(38,39)36-23-11-18-32(33(36)24-34(37)30-16-9-4-10-17-30)35(25-28-12-5-2-6-13-28)26-29-14-7-3-8-15-29/h2-10,12-17,19-22,32-33H,11,18,23-26H2,1H3/t32-,33-/m0/s1 |
| InChIKey | YQMWIOSRMINIRW-LQJZCPKCSA-N |
| XLogP | 6.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |