C27H30FO7P — CID 102459903
[(2R,3R,4R,5S,6R)-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid (PubChem CID 102459903) has the molecular formula C27H30FO7P and a molecular weight of 516.50 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid.
| Compound Name | [(2R,3R,4R,5S,6R)-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 102459903 |
| Molecular Formula | C27H30FO7P |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-fluoro-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)[C@H]1O[C@H](COCc2ccccc2)[C@H](F)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30FO7P/c28-24-23(19-32-16-20-10-4-1-5-11-20)35-27(36(29,30)31)26(34-18-22-14-8-3-9-15-22)25(24)33-17-21-12-6-2-7-13-21/h1-15,23-27H,16-19H2,(H2,29,30,31)/t23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | DKVVTSRPVLYTEX-LXSUACKSSA-N |
| XLogP | 4.61 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|