C28H33O8P — CID 90358087
[(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methylphosphonic acid (PubChem CID 90358087) has the molecular formula C28H33O8P and a molecular weight of 528.54 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methylphosphonic acid.
| Compound Name | [(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 90358087 |
| Molecular Formula | C28H33O8P |
| Molecular Weight | 528.54 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methylphosphonic acid |
| SMILES | O=P(O)(O)C[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C28H33O8P/c29-26-25(20-37(30,31)32)36-24(19-33-16-21-10-4-1-5-11-21)27(34-17-22-12-6-2-7-13-22)28(26)35-18-23-14-8-3-9-15-23/h1-15,24-29H,16-20H2,(H2,30,31,32)/t24-,25-,26+,27-,28-/m1/s1 |
| InChIKey | ZPOYPGUSOLTLNE-RKFAPSRVSA-N |
| XLogP | 3.68 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|