C30H44O13Si — CID 102460744
methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropanoate (PubChem CID 102460744) has the molecular formula C30H44O13Si and a molecular weight of 640.76 g/mol. Its IUPAC name is methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropanoate.
| Compound Name | methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 102460744 |
| Molecular Formula | C30H44O13Si |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)C(Cc1ccc(O[Si](C)(C)C(C)(C)C)cc1)O[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H44O13Si/c1-17(31)37-16-24-25(38-18(2)32)26(39-19(3)33)27(40-20(4)34)29(42-24)41-23(28(35)36-8)15-21-11-13-22(14-12-21)43-44(9,10)30(5,6)7/h11-14,23-27,29H,15-16H2,1-10H3/t23?,24-,25+,26+,27-,29-/m1/s1 |
| InChIKey | XGURBLUXRALOIP-FLSAQAFBSA-N |
| XLogP | 3.25 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|