C20H23NO — CID 102461679
N-benzyl-N-(4,4-dimethyl-1-phenylpent-1-yn-3-yl)hydroxylamine (PubChem CID 102461679) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is N-benzyl-N-(4,4-dimethyl-1-phenylpent-1-yn-3-yl)hydroxylamine.
| Compound Name | N-benzyl-N-(4,4-dimethyl-1-phenylpent-1-yn-3-yl)hydroxylamine |
|---|---|
| PubChem CID | 102461679 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-benzyl-N-(4,4-dimethyl-1-phenylpent-1-yn-3-yl)hydroxylamine |
| SMILES | CC(C)(C)C(C#Cc1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO/c1-20(2,3)19(15-14-17-10-6-4-7-11-17)21(22)16-18-12-8-5-9-13-18/h4-13,19,22H,16H2,1-3H3 |
| InChIKey | XAJWZNWXLHWEEO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|