C23H31NO2Si — CID 102461681
N-benzyl-N-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-2-ynyl]hydroxylamine (PubChem CID 102461681) has the molecular formula C23H31NO2Si and a molecular weight of 381.59 g/mol. Its IUPAC name is N-benzyl-N-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-2-ynyl]hydroxylamine.
| Compound Name | N-benzyl-N-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-2-ynyl]hydroxylamine |
|---|---|
| PubChem CID | 102461681 |
| Molecular Formula | C23H31NO2Si |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-benzyl-N-[4-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-2-ynyl]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OCC#CC(c1ccccc1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H31NO2Si/c1-23(2,3)27(4,5)26-18-12-17-22(21-15-10-7-11-16-21)24(25)19-20-13-8-6-9-14-20/h6-11,13-16,22,25H,18-19H2,1-5H3 |
| InChIKey | AHQBWNUEZKTEBW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|