C21H25NO3 — CID 15546565
N-benzyl-N-(4,4-diethoxy-1-phenylbut-2-ynyl)hydroxylamine (PubChem CID 15546565) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-benzyl-N-(4,4-diethoxy-1-phenylbut-2-ynyl)hydroxylamine.
| Compound Name | N-benzyl-N-(4,4-diethoxy-1-phenylbut-2-ynyl)hydroxylamine |
|---|---|
| PubChem CID | 15546565 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-benzyl-N-(4,4-diethoxy-1-phenylbut-2-ynyl)hydroxylamine |
| SMILES | CCOC(C#CC(c1ccccc1)N(O)Cc1ccccc1)OCC |
| InChI | InChI=1S/C21H25NO3/c1-3-24-21(25-4-2)16-15-20(19-13-9-6-10-14-19)22(23)17-18-11-7-5-8-12-18/h5-14,20-21,23H,3-4,17H2,1-2H3 |
| InChIKey | COJKIDYMGAOZOL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|