C23H29NO2 — CID 102462865
2-(dimethylamino)-3,3-dimethyl-1-phenyl-4-[(E)-3-phenylprop-2-enoxy]butan-1-one (PubChem CID 102462865) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-(dimethylamino)-3,3-dimethyl-1-phenyl-4-[(E)-3-phenylprop-2-enoxy]butan-1-one.
| Compound Name | 2-(dimethylamino)-3,3-dimethyl-1-phenyl-4-[(E)-3-phenylprop-2-enoxy]butan-1-one |
|---|---|
| PubChem CID | 102462865 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-(dimethylamino)-3,3-dimethyl-1-phenyl-4-[(E)-3-phenylprop-2-enoxy]butan-1-one |
| SMILES | CN(C)C(C(=O)c1ccccc1)C(C)(C)COC/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-23(2,18-26-17-11-14-19-12-7-5-8-13-19)22(24(3)4)21(25)20-15-9-6-10-16-20/h5-16,22H,17-18H2,1-4H3/b14-11+ |
| InChIKey | YNKXCGHLJXSMOE-SDNWHVSQSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|