C35H33NO7 — CID 102463057
methyl 4-[4-[3-ethoxy-2-formamido-2-[[4-(4-methoxycarbonylphenyl)phenyl]methyl]-3-oxopropyl]phenyl]benzoate (PubChem CID 102463057) has the molecular formula C35H33NO7 and a molecular weight of 579.65 g/mol. Its IUPAC name is methyl 4-[4-[3-ethoxy-2-formamido-2-[[4-(4-methoxycarbonylphenyl)phenyl]methyl]-3-oxopropyl]phenyl]benzoate.
| Compound Name | methyl 4-[4-[3-ethoxy-2-formamido-2-[[4-(4-methoxycarbonylphenyl)phenyl]methyl]-3-oxopropyl]phenyl]benzoate |
|---|---|
| PubChem CID | 102463057 |
| Molecular Formula | C35H33NO7 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | methyl 4-[4-[3-ethoxy-2-formamido-2-[[4-(4-methoxycarbonylphenyl)phenyl]methyl]-3-oxopropyl]phenyl]benzoate |
| SMILES | CCOC(=O)C(Cc1ccc(-c2ccc(C(=O)OC)cc2)cc1)(Cc1ccc(-c2ccc(C(=O)OC)cc2)cc1)NC=O |
| InChI | InChI=1S/C35H33NO7/c1-4-43-34(40)35(36-23-37,21-24-5-9-26(10-6-24)28-13-17-30(18-14-28)32(38)41-2)22-25-7-11-27(12-8-25)29-15-19-31(20-16-29)33(39)42-3/h5-20,23H,4,21-22H2,1-3H3,(H,36,37) |
| InChIKey | CURSCVZULBMDDH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|