C18H28NNaO4S — CID 102464522
sodium 4-nonyl-2-(2-sulfoethyliminomethyl)phenolate (PubChem CID 102464522) has the molecular formula C18H28NNaO4S and a molecular weight of 377.48 g/mol. Its IUPAC name is sodium 4-nonyl-2-(2-sulfoethyliminomethyl)phenolate.
| Compound Name | sodium 4-nonyl-2-(2-sulfoethyliminomethyl)phenolate |
|---|---|
| PubChem CID | 102464522 |
| Molecular Formula | C18H28NNaO4S |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | sodium 4-nonyl-2-(2-sulfoethyliminomethyl)phenolate |
| SMILES | CCCCCCCCCc1ccc([O-])c(/C=N/CCS(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C18H29NO4S.Na/c1-2-3-4-5-6-7-8-9-16-10-11-18(20)17(14-16)15-19-12-13-24(21,22)23;/h10-11,14-15,20H,2-9,12-13H2,1H3,(H,21,22,23);/q;+1/p-1/b19-15+; |
| InChIKey | GYTHYHFZJRADIO-QTCZRQAZSA-M |
| XLogP | 0.36 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|