C13H17N — CID 102464892
(2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine (PubChem CID 102464892) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine.
| Compound Name | (2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine |
|---|---|
| PubChem CID | 102464892 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2E)-2-[(2Z,4E)-4-prop-2-enylidenecyclooct-2-en-1-ylidene]ethanimine |
| SMILES | [H]/N=C/C=C1/C=C\C(=C\C=C)CCCC1 |
| InChI | InChI=1S/C13H17N/c1-2-5-12-6-3-4-7-13(9-8-12)10-11-14/h2,5,8-11,14H,1,3-4,6-7H2/b9-8-,12-5+,13-10+,14-11+ |
| InChIKey | MOGZDHVMRNAWPC-KCRJFXAOSA-N |
| XLogP | 3.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|