C10H17N — CID 118974505
(2Z,4Z)-2-butylhexa-2,4-dien-1-imine (PubChem CID 118974505) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2Z,4Z)-2-butylhexa-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-2-butylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 118974505 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2Z,4Z)-2-butylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C/C)CCCC |
| InChI | InChI=1S/C10H17N/c1-3-5-7-10(9-11)8-6-4-2/h3,5,7,9,11H,4,6,8H2,1-2H3/b5-3-,10-7-,11-9+ |
| InChIKey | VLGKTRSVELNBCP-RYWRVUGXSA-N |
| XLogP | 3.33 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|