C11H18FN — CID 146318082
(2E)-4-fluoro-2,3-dimethylnona-2,8-dien-1-imine (PubChem CID 146318082) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (2E)-4-fluoro-2,3-dimethylnona-2,8-dien-1-imine.
| Compound Name | (2E)-4-fluoro-2,3-dimethylnona-2,8-dien-1-imine |
|---|---|
| PubChem CID | 146318082 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (2E)-4-fluoro-2,3-dimethylnona-2,8-dien-1-imine |
| SMILES | [H]/N=C/C(C)=C(\C)C(F)CCCC=C |
| InChI | InChI=1S/C11H18FN/c1-4-5-6-7-11(12)10(3)9(2)8-13/h4,8,11,13H,1,5-7H2,2-3H3/b10-9+,13-8+ |
| InChIKey | OCTKEQYOLFDMAR-URERACSSSA-N |
| XLogP | 3.67 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|