C19H17ClN2O5 — CID 102466463
prop-2-enyl (4S)-2-amino-6-chloro-4-[(1R)-1-cyano-2-oxo-2-prop-2-enoxyethyl]-4H-chromene-3-carboxylate (PubChem CID 102466463) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is prop-2-enyl (4S)-2-amino-6-chloro-4-[(1R)-1-cyano-2-oxo-2-prop-2-enoxyethyl]-4H-chromene-3-carboxylate.
| Compound Name | prop-2-enyl (4S)-2-amino-6-chloro-4-[(1R)-1-cyano-2-oxo-2-prop-2-enoxyethyl]-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 102466463 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | prop-2-enyl (4S)-2-amino-6-chloro-4-[(1R)-1-cyano-2-oxo-2-prop-2-enoxyethyl]-4H-chromene-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(N)Oc2ccc(Cl)cc2[C@@H]1[C@H](C#N)C(=O)OCC=C |
| InChI | InChI=1S/C19H17ClN2O5/c1-3-7-25-18(23)13(10-21)15-12-9-11(20)5-6-14(12)27-17(22)16(15)19(24)26-8-4-2/h3-6,9,13,15H,1-2,7-8,22H2/t13-,15+/m0/s1 |
| InChIKey | WDBGALCAMRRSEY-DZGCQCFKSA-N |
| XLogP | 2.58 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|