C27H35N3O4 — CID 102467054
1-[1-[(2R,4S,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]triazol-4-yl]hexan-1-ol (PubChem CID 102467054) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is 1-[1-[(2R,4S,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]triazol-4-yl]hexan-1-ol.
| Compound Name | 1-[1-[(2R,4S,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]triazol-4-yl]hexan-1-ol |
|---|---|
| PubChem CID | 102467054 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 1-[1-[(2R,4S,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]triazol-4-yl]hexan-1-ol |
| SMILES | CCCCCC(O)c1cn([C@H]2C[C@H](Oc3ccc(C)cc3)[C@@H](COc3ccc(C)cc3)O2)nn1 |
| InChI | InChI=1S/C27H35N3O4/c1-4-5-6-7-24(31)23-17-30(29-28-23)27-16-25(33-22-14-10-20(3)11-15-22)26(34-27)18-32-21-12-8-19(2)9-13-21/h8-15,17,24-27,31H,4-7,16,18H2,1-3H3/t24?,25-,26+,27+/m0/s1 |
| InChIKey | YISCYTDMZMAGKQ-ZHOVUOCFSA-N |
| XLogP | 5.32 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|