C33H33N5O5 — CID 135007559
6-(ethylamino)-1-[(2R,4R,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]-2-phenyl-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione (PubChem CID 135007559) has the molecular formula C33H33N5O5 and a molecular weight of 579.66 g/mol. Its IUPAC name is 6-(ethylamino)-1-[(2R,4R,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]-2-phenyl-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione.
| Compound Name | 6-(ethylamino)-1-[(2R,4R,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]-2-phenyl-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
|---|---|
| PubChem CID | 135007559 |
| Molecular Formula | C33H33N5O5 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 6-(ethylamino)-1-[(2R,4R,5R)-4-(4-methylphenoxy)-5-[(4-methylphenoxy)methyl]oxolan-2-yl]-2-phenyl-7H-imidazo[4,5-e][1,3]diazepine-4,8-dione |
| SMILES | CCNc1nc(=O)c2nc(-c3ccccc3)n([C@H]3C[C@@H](Oc4ccc(C)cc4)[C@@H](COc4ccc(C)cc4)O3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C33H33N5O5/c1-4-34-33-36-31(39)28-29(32(40)37-33)38(30(35-28)22-8-6-5-7-9-22)27-18-25(42-24-16-12-21(3)13-17-24)26(43-27)19-41-23-14-10-20(2)11-15-23/h5-17,25-27H,4,18-19H2,1-3H3,(H2,34,36,37,39,40)/t25-,26-,27-/m1/s1 |
| InChIKey | WDYVIFLEWAWFDE-ZONZVBGPSA-N |
| XLogP | 5.01 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |