C20H35NO6S — CID 102467140
2-[2-[2-[(4R,5S)-5-(methylamino)-4-phenylhexoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 102467140) has the molecular formula C20H35NO6S and a molecular weight of 417.57 g/mol. Its IUPAC name is 2-[2-[2-[(4R,5S)-5-(methylamino)-4-phenylhexoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[(4R,5S)-5-(methylamino)-4-phenylhexoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 102467140 |
| Molecular Formula | C20H35NO6S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[2-[2-[(4R,5S)-5-(methylamino)-4-phenylhexoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CN[C@@H](C)[C@H](CCCOCCOCCOCCOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C20H35NO6S/c1-18(21-2)20(19-8-5-4-6-9-19)10-7-11-24-12-13-25-14-15-26-16-17-27-28(3,22)23/h4-6,8-9,18,20-21H,7,10-17H2,1-3H3/t18-,20-/m0/s1 |
| InChIKey | WODZFSNXZULMJV-ICSRJNTNSA-N |
| XLogP | 2.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|