C11H15NO4S — CID 91310018
2-(1-phenylethenylamino)oxyethyl methanesulfonate (PubChem CID 91310018) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(1-phenylethenylamino)oxyethyl methanesulfonate.
| Compound Name | 2-(1-phenylethenylamino)oxyethyl methanesulfonate |
|---|---|
| PubChem CID | 91310018 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-(1-phenylethenylamino)oxyethyl methanesulfonate |
| SMILES | C=C(NOCCOS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C11H15NO4S/c1-10(11-6-4-3-5-7-11)12-15-8-9-16-17(2,13)14/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | DKSWQJAPQQXHFZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|