C28H37ClO7 — CID 102468797
(4S,5S,10R,13S,15S,16R,17R,20S)-4-chloro-15-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-5,13,17-trihydroxy-10,16,20-trimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one (PubChem CID 102468797) has the molecular formula C28H37ClO7 and a molecular weight of 521.05 g/mol. Its IUPAC name is (4S,5S,10R,13S,15S,16R,17R,20S)-4-chloro-15-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-5,13,17-trihydroxy-10,16,20-trimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one.
| Compound Name | (4S,5S,10R,13S,15S,16R,17R,20S)-4-chloro-15-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-5,13,17-trihydroxy-10,16,20-trimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one |
|---|---|
| PubChem CID | 102468797 |
| Molecular Formula | C28H37ClO7 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (4S,5S,10R,13S,15S,16R,17R,20S)-4-chloro-15-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-5,13,17-trihydroxy-10,16,20-trimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one |
| SMILES | CC1=C(C)C([C@H]2O[C@@]3(O)CC4C(C[C@H](Cl)[C@]5(O)CC=CC(=O)[C@]45C)C4CC[C@@](O)([C@@H]2C)[C@]43C)OC1=O |
| InChI | InChI=1S/C28H37ClO7/c1-13-14(2)23(31)35-21(13)22-15(3)26(32)10-8-17-16-11-19(29)27(33)9-6-7-20(30)24(27,4)18(16)12-28(34,36-22)25(17,26)5/h6-7,15-19,21-22,32-34H,8-12H2,1-5H3/t15-,16?,17?,18?,19+,21?,22+,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | HKTSJGOKYYETBF-VCRJHXSNSA-N |
| XLogP | 3.03 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|