C28H37ClO7 — CID 72984424
5-chloro-4,13,17-trihydroxy-4',5',10,16,20-pentamethylspiro[14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-ene-15,2'-3H-pyran]-6',9-dione (PubChem CID 72984424) has the molecular formula C28H37ClO7 and a molecular weight of 521.05 g/mol. Its IUPAC name is 5-chloro-4,13,17-trihydroxy-4',5',10,16,20-pentamethylspiro[14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-ene-15,2'-3H-pyran]-6',9-dione.
| Compound Name | 5-chloro-4,13,17-trihydroxy-4',5',10,16,20-pentamethylspiro[14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-ene-15,2'-3H-pyran]-6',9-dione |
|---|---|
| PubChem CID | 72984424 |
| Molecular Formula | C28H37ClO7 |
| Molecular Weight | 521.05 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | 5-chloro-4,13,17-trihydroxy-4',5',10,16,20-pentamethylspiro[14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-ene-15,2'-3H-pyran]-6',9-dione |
| SMILES | CC1=C(C)C(=O)OC2(C1)OC1(O)CC3C(CC(O)C4(Cl)CC=CC(=O)C34C)C3CCC(O)(C2C)C31C |
| InChI | InChI=1S/C28H37ClO7/c1-14-12-27(35-22(32)15(14)2)16(3)26(33)10-8-18-17-11-21(31)25(29)9-6-7-20(30)23(25,4)19(17)13-28(34,36-27)24(18,26)5/h6-7,16-19,21,31,33-34H,8-13H2,1-5H3 |
| InChIKey | VWXZQPLXTOJKNO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.05 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|