C21H19NO3S — CID 102469430
3-(benzenesulfonyl)-2,4-diphenyl-1,3-oxazolidine (PubChem CID 102469430) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,4-diphenyl-1,3-oxazolidine.
| Compound Name | 3-(benzenesulfonyl)-2,4-diphenyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 102469430 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-(benzenesulfonyl)-2,4-diphenyl-1,3-oxazolidine |
| SMILES | O=S(=O)(c1ccccc1)N1C(c2ccccc2)COC1c1ccccc1 |
| InChI | InChI=1S/C21H19NO3S/c23-26(24,19-14-8-3-9-15-19)22-20(17-10-4-1-5-11-17)16-25-21(22)18-12-6-2-7-13-18/h1-15,20-21H,16H2 |
| InChIKey | RVRUIPBFEJXYEC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |