C25H32N2O5 — CID 102471738
(3S,6R,11aS)-3-[(2,5-dimethoxyphenyl)methyl]-7,10-dimethoxy-2,6-dimethyl-3,6,11,11a-tetrahydro-1H-pyrazino[1,2-b]isoquinolin-4-one (PubChem CID 102471738) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is (3S,6R,11aS)-3-[(2,5-dimethoxyphenyl)methyl]-7,10-dimethoxy-2,6-dimethyl-3,6,11,11a-tetrahydro-1H-pyrazino[1,2-b]isoquinolin-4-one.
| Compound Name | (3S,6R,11aS)-3-[(2,5-dimethoxyphenyl)methyl]-7,10-dimethoxy-2,6-dimethyl-3,6,11,11a-tetrahydro-1H-pyrazino[1,2-b]isoquinolin-4-one |
|---|---|
| PubChem CID | 102471738 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | (3S,6R,11aS)-3-[(2,5-dimethoxyphenyl)methyl]-7,10-dimethoxy-2,6-dimethyl-3,6,11,11a-tetrahydro-1H-pyrazino[1,2-b]isoquinolin-4-one |
| SMILES | COc1ccc(OC)c(C[C@H]2C(=O)N3[C@@H](Cc4c(OC)ccc(OC)c4[C@H]3C)CN2C)c1 |
| InChI | InChI=1S/C25H32N2O5/c1-15-24-19(22(31-5)9-10-23(24)32-6)13-17-14-26(2)20(25(28)27(15)17)12-16-11-18(29-3)7-8-21(16)30-4/h7-11,15,17,20H,12-14H2,1-6H3/t15-,17+,20+/m1/s1 |
| InChIKey | KZNIDDUPKRTFPJ-SYNHAJSKSA-N |
| XLogP | 3.09 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |