C14H16O5 — CID 102473313
(3R,6R,7S,8R)-1-methyl-7-phenylmethoxy-2,4,9,10-tetraoxatricyclo[4.3.1.03,8]decane (PubChem CID 102473313) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3R,6R,7S,8R)-1-methyl-7-phenylmethoxy-2,4,9,10-tetraoxatricyclo[4.3.1.03,8]decane.
| Compound Name | (3R,6R,7S,8R)-1-methyl-7-phenylmethoxy-2,4,9,10-tetraoxatricyclo[4.3.1.03,8]decane |
|---|---|
| PubChem CID | 102473313 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (3R,6R,7S,8R)-1-methyl-7-phenylmethoxy-2,4,9,10-tetraoxatricyclo[4.3.1.03,8]decane |
| SMILES | CC12O[C@H]3OC[C@@H](O1)[C@H](OCc1ccccc1)[C@H]3O2 |
| InChI | InChI=1S/C14H16O5/c1-14-17-10-8-16-13(19-14)12(18-14)11(10)15-7-9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3/t10-,11+,12-,13-,14?/m1/s1 |
| InChIKey | MIJIWFISXNYGPK-DYPLGBCKSA-N |
| XLogP | 1.42 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |