C15H23NO2Si — CID 102474513
(3R,5S)-3-ethenyl-1-prop-2-enoyl-5-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidin-2-one (PubChem CID 102474513) has the molecular formula C15H23NO2Si and a molecular weight of 277.44 g/mol. Its IUPAC name is (3R,5S)-3-ethenyl-1-prop-2-enoyl-5-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidin-2-one.
| Compound Name | (3R,5S)-3-ethenyl-1-prop-2-enoyl-5-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102474513 |
| Molecular Formula | C15H23NO2Si |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (3R,5S)-3-ethenyl-1-prop-2-enoyl-5-[(E)-3-trimethylsilylprop-1-enyl]pyrrolidin-2-one |
| SMILES | C=CC(=O)N1C(=O)[C@@H](C=C)C[C@H]1/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C15H23NO2Si/c1-6-12-11-13(9-8-10-19(3,4)5)16(15(12)18)14(17)7-2/h6-9,12-13H,1-2,10-11H2,3-5H3/b9-8+/t12-,13+/m0/s1 |
| InChIKey | RJXSRBRDUCNHBD-AYSSICMYSA-N |
| XLogP | 3.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|