C15H14O2 — CID 102475018
2-methyl-3-phenyl-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 102475018) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-methyl-3-phenyl-6,7-dihydro-5H-1-benzofuran-4-one.
| Compound Name | 2-methyl-3-phenyl-6,7-dihydro-5H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 102475018 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-methyl-3-phenyl-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | Cc1oc2c(c1-c1ccccc1)C(=O)CCC2 |
| InChI | InChI=1S/C15H14O2/c1-10-14(11-6-3-2-4-7-11)15-12(16)8-5-9-13(15)17-10/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | VXPWNMFNUZPGQJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |