C19H16O2 — CID 102475019
2-methyl-3-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 102475019) has the molecular formula C19H16O2 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-methyl-3-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-4-one.
| Compound Name | 2-methyl-3-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 102475019 |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-methyl-3-naphthalen-1-yl-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | Cc1oc2c(c1-c1cccc3ccccc13)C(=O)CCC2 |
| InChI | InChI=1S/C19H16O2/c1-12-18(19-16(20)10-5-11-17(19)21-12)15-9-4-7-13-6-2-3-8-14(13)15/h2-4,6-9H,5,10-11H2,1H3 |
| InChIKey | NYJWPSMSTGSCRS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |