About 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde
4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde (PubChem CID 56647978) has the molecular formula C15H12O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
| PubChem CID | 56647978 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
| SMILES | O=Cc1oc2c(c1-c1ccccc1)C(=O)CCC2 |
| InChI | InChI=1S/C15H12O3/c16-9-13-14(10-5-2-1-3-6-10)15-11(17)7-4-8-12(15)18-13/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | ABACEDJBZGXKQL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde?
The IUPAC name of 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde (CID 56647978) is 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde.
What is the SMILES notation for 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde?
The canonical SMILES for 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde is O=Cc1oc2c(c1-c1ccccc1)C(=O)CCC2.
What is the InChIKey of 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde?
The InChIKey is ABACEDJBZGXKQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O3/c16-9-13-14(10-5-2-1-3-6-10)15-11(17)7-4-8-12(15)18-13/h1-3,5-6,9H,4,7-8H2.
What are the key properties of 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde?
4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde has a molecular weight of 240.26 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde is sourced from PubChem (CID 56647978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).