C15H12O3 — CID 56647978
4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde (PubChem CID 56647978) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde.
| Compound Name | 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 56647978 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 4-oxo-3-phenyl-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
| SMILES | O=Cc1oc2c(c1-c1ccccc1)C(=O)CCC2 |
| InChI | InChI=1S/C15H12O3/c16-9-13-14(10-5-2-1-3-6-10)15-11(17)7-4-8-12(15)18-13/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | ABACEDJBZGXKQL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|