C10H10O3 — CID 56647977
3-methyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde (PubChem CID 56647977) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-methyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde.
| Compound Name | 3-methyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 56647977 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-methyl-4-oxo-6,7-dihydro-5H-1-benzofuran-2-carbaldehyde |
| SMILES | Cc1c(C=O)oc2c1C(=O)CCC2 |
| InChI | InChI=1S/C10H10O3/c1-6-9(5-11)13-8-4-2-3-7(12)10(6)8/h5H,2-4H2,1H3 |
| InChIKey | ZYSTYVOHNUHXQH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|