C24H45N9O7 — CID 102475418
(2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-6-(3-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 102475418) has the molecular formula C24H45N9O7 and a molecular weight of 571.68 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-6-(3-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-6-(3-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 102475418 |
| Molecular Formula | C24H45N9O7 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | (2S)-2-[[(2S)-1-[(2S)-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]-6-(3-aminopropanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](CCCCNC(=O)CCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H45N9O7/c1-14(34)19(26)21(37)31-15(6-2-3-11-29-18(35)9-10-25)22(38)33-13-5-8-17(33)20(36)32-16(23(39)40)7-4-12-30-24(27)28/h14-17,19,34H,2-13,25-26H2,1H3,(H,29,35)(H,31,37)(H,32,36)(H,39,40)(H4,27,28,30)/t14-,15+,16+,17+,19+/m1/s1 |
| InChIKey | QFHYQSGOEFENBU-QSUVVDIXSA-N |
| XLogP | -3.57 |
| TPSA | 281.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|