C21H42N8O4 — CID 140872323
(2S)-1-[6-amino-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]hexanoyl]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 140872323) has the molecular formula C21H42N8O4 and a molecular weight of 470.62 g/mol. Its IUPAC name is (2S)-1-[6-amino-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]hexanoyl]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[6-amino-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]hexanoyl]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140872323 |
| Molecular Formula | C21H42N8O4 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | (2S)-1-[6-amino-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]hexanoyl]-N-[(2R)-5-(diaminomethylideneamino)pentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)C(CCCCN)NC(=O)[C@@H](N)[C@@H](C)O |
| InChI | InChI=1S/C21H42N8O4/c1-13(7-5-11-26-21(24)25)27-18(31)16-9-6-12-29(16)20(33)15(8-3-4-10-22)28-19(32)17(23)14(2)30/h13-17,30H,3-12,22-23H2,1-2H3,(H,27,31)(H,28,32)(H4,24,25,26)/t13-,14-,15?,16+,17+/m1/s1 |
| InChIKey | RXGWYRVFYHRTLG-ZZHMGZFRSA-N |
| XLogP | -2.14 |
| TPSA | 215.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|