C27H49N9O6 — CID 21053973
1-[1-[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 21053973) has the molecular formula C27H49N9O6 and a molecular weight of 595.75 g/mol. Its IUPAC name is 1-[1-[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[1-[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 21053973 |
| Molecular Formula | C27H49N9O6 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.38 |
| IUPAC Name | 1-[1-[6-amino-2-[(2-amino-3-hydroxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]-N-[6-(diaminomethylideneamino)-2-oxohexan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)C(CCCN=C(N)N)NC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(N)C(C)O |
| InChI | InChI=1S/C27H49N9O6/c1-16(37)18(9-5-13-32-27(30)31)33-23(39)20-10-6-14-35(20)26(42)21-11-7-15-36(21)25(41)19(8-3-4-12-28)34-24(40)22(29)17(2)38/h17-22,38H,3-15,28-29H2,1-2H3,(H,33,39)(H,34,40)(H4,30,31,32) |
| InChIKey | RCJYEODSFWCESD-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 252.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|