C14H17BrO6 — CID 102478742
(4aR,7R,8S,8aR)-8-(bromomethyl)-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,7,8-triol (PubChem CID 102478742) has the molecular formula C14H17BrO6 and a molecular weight of 361.19 g/mol. Its IUPAC name is (4aR,7R,8S,8aR)-8-(bromomethyl)-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,7,8-triol.
| Compound Name | (4aR,7R,8S,8aR)-8-(bromomethyl)-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,7,8-triol |
|---|---|
| PubChem CID | 102478742 |
| Molecular Formula | C14H17BrO6 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (4aR,7R,8S,8aR)-8-(bromomethyl)-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-6,7,8-triol |
| SMILES | OC1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@](O)(CBr)[C@H]1O |
| InChI | InChI=1S/C14H17BrO6/c15-7-14(18)10(16)12(17)20-9-6-19-13(21-11(9)14)8-4-2-1-3-5-8/h1-5,9-13,16-18H,6-7H2/t9-,10+,11-,12?,13?,14+/m1/s1 |
| InChIKey | KQFFCMYIQDACRL-OXPXWGEWSA-N |
| XLogP | 0.30 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|