C14H16BFO3 — CID 87157759
CID 87157759 (PubChem CID 87157759) has the molecular formula C14H16BFO3 and a molecular weight of 262.09 g/mol.
| Compound Name | CID 87157759 |
|---|---|
| PubChem CID | 87157759 |
| Molecular Formula | C14H16BFO3 |
| Molecular Weight | 262.09 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1CO[C@@H]2CO[C@@H](c3ccccc3)OC2[C@@]1(C)F |
| InChI | InChI=1S/C14H16BFO3/c1-14(16)11(15)8-17-10-7-18-13(19-12(10)14)9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3/t10-,11-,12?,13-,14+/m1/s1 |
| InChIKey | YCAHRQRDJQESMW-DUJLVANISA-N |
| XLogP | 2.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.09 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|