C9H15ClO — CID 102479443
(1S,5R)-7-(chloromethyl)-3-oxabicyclo[3.3.1]nonane (PubChem CID 102479443) has the molecular formula C9H15ClO and a molecular weight of 174.67 g/mol. Its IUPAC name is (1S,5R)-7-(chloromethyl)-3-oxabicyclo[3.3.1]nonane.
| Compound Name | (1S,5R)-7-(chloromethyl)-3-oxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102479443 |
| Molecular Formula | C9H15ClO |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (1S,5R)-7-(chloromethyl)-3-oxabicyclo[3.3.1]nonane |
| SMILES | ClCC1C[C@H]2COC[C@@H](C1)C2 |
| InChI | InChI=1S/C9H15ClO/c10-4-7-1-8-3-9(2-7)6-11-5-8/h7-9H,1-6H2/t7?,8-,9+ |
| InChIKey | FMQTWIZKZJOCHQ-CBLAIPOGSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|