C8H14INS2 — CID 102480040
N-butan-2-yl-4-(iodomethyl)-1,3-dithiolan-2-imine (PubChem CID 102480040) has the molecular formula C8H14INS2 and a molecular weight of 315.25 g/mol. Its IUPAC name is N-butan-2-yl-4-(iodomethyl)-1,3-dithiolan-2-imine.
| Compound Name | N-butan-2-yl-4-(iodomethyl)-1,3-dithiolan-2-imine |
|---|---|
| PubChem CID | 102480040 |
| Molecular Formula | C8H14INS2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | N-butan-2-yl-4-(iodomethyl)-1,3-dithiolan-2-imine |
| SMILES | CCC(C)/N=C1\SCC(CI)S1 |
| InChI | InChI=1S/C8H14INS2/c1-3-6(2)10-8-11-5-7(4-9)12-8/h6-7H,3-5H2,1-2H3/b10-8+ |
| InChIKey | MSXICUMSEFUMAS-CSKARUKUSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|