About N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine
N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine (PubChem CID 102480042) has the molecular formula C9H16INS2
and a molecular weight of 329.27 g/mol. Its IUPAC name is N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine.
Molecular Properties
| Compound Name | N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine |
| PubChem CID | 102480042 |
| Molecular Formula | C9H16INS2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine |
| SMILES | CCCC/N=C1\SCC(C(C)I)S1 |
| InChI | InChI=1S/C9H16INS2/c1-3-4-5-11-9-12-6-8(13-9)7(2)10/h7-8H,3-6H2,1-2H3/b11-9+ |
| InChIKey | DTHCRMDYXVEEIC-PKNBQFBNSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine?
The IUPAC name of N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine (CID 102480042) is N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine.
What is the SMILES notation for N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine?
The canonical SMILES for N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine is CCCC/N=C1\SCC(C(C)I)S1.
What is the InChIKey of N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine?
The InChIKey is DTHCRMDYXVEEIC-PKNBQFBNSA-N. The full InChI is InChI=1S/C9H16INS2/c1-3-4-5-11-9-12-6-8(13-9)7(2)10/h7-8H,3-6H2,1-2H3/b11-9+.
What are the key properties of N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine?
N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine has a molecular weight of 329.27 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine is sourced from PubChem (CID 102480042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).