C9H16INS2 — CID 102480042
N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine (PubChem CID 102480042) has the molecular formula C9H16INS2 and a molecular weight of 329.27 g/mol. Its IUPAC name is N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine.
| Compound Name | N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine |
|---|---|
| PubChem CID | 102480042 |
| Molecular Formula | C9H16INS2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-butyl-4-(1-iodoethyl)-1,3-dithiolan-2-imine |
| SMILES | CCCC/N=C1\SCC(C(C)I)S1 |
| InChI | InChI=1S/C9H16INS2/c1-3-4-5-11-9-12-6-8(13-9)7(2)10/h7-8H,3-6H2,1-2H3/b11-9+ |
| InChIKey | DTHCRMDYXVEEIC-PKNBQFBNSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|