C14H26N2O2S — CID 134148190
(6S,7S,7aR)-3-octylimino-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol (PubChem CID 134148190) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is (6S,7S,7aR)-3-octylimino-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol.
| Compound Name | (6S,7S,7aR)-3-octylimino-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 134148190 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (6S,7S,7aR)-3-octylimino-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-diol |
| SMILES | CCCCCCCC/N=C1\SC[C@H]2[C@H](O)[C@@H](O)CN12 |
| InChI | InChI=1S/C14H26N2O2S/c1-2-3-4-5-6-7-8-15-14-16-9-12(17)13(18)11(16)10-19-14/h11-13,17-18H,2-10H2,1H3/b15-14-/t11-,12-,13-/m0/s1 |
| InChIKey | UZNSOHBBKVVYLF-GUVFVBGMSA-N |
| XLogP | 1.86 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|